CAS 1803561-82-1 appears in our catalog under these names: 2-Amino-3-hydroxy-5,5-dimethylhexanoic acid hydrochloride, 95%, 2-Amino-3-hydroxy-5,5-dimethylhexanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-3-hydroxy-5,5-dimethylhexanoic acid;hydrochloride (CAS 1803561-82-1) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: 2-amino-3-hydroxy-5,5-dimethylhexanoic acid;hydrochloride. InChIKey: ODCSPVSRZKOFFB-UHFFFAOYSA-N.
| Molecular formula | C8H18ClNO3 |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | 2-amino-3-hydroxy-5,5-dimethylhexanoic acid;hydrochloride |
| InChIKey | ODCSPVSRZKOFFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C(C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)