Products 1803565-95-8

CAS 1803565-95-8 is the registry number for tert-Butyl 3-(1,2,4-oxadiazol-5-yl)morpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(1,2,4-oxadiazol-5-yl)morpholine-4-carboxylate (CAS 1803565-95-8) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: tert-butyl 3-(1,2,4-oxadiazol-5-yl)morpholine-4-carboxylate. InChIKey: NZCZEDNOGCFLER-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17N3O4
Molecular weight255.27 g/mol
IUPAC nametert-butyl 3-(1,2,4-oxadiazol-5-yl)morpholine-4-carboxylate
InChIKeyNZCZEDNOGCFLER-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOCC1C2=NC=NO2

Computed by PubChem (NCBI)