Products 20423-20-5
CAS 20423-20-5 is the registry number for 1-Chloro-2-(diethoxymethyl)-4-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-chloro-2-(diethoxymethyl)-4-nitrobenzene (CAS 20423-20-5) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: 1-chloro-2-(diethoxymethyl)-4-nitrobenzene. InChIKey: JFLYMTLKDYMKRQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 1-chloro-2-(diethoxymethyl)-4-nitrobenzene |
| InChIKey | JFLYMTLKDYMKRQ-UHFFFAOYSA-N |
| SMILES | CCOC(C1=C(C=CC(=C1)[N+](=O)[O-])Cl)OCC |
Computed by PubChem (NCBI)