CAS 2059917-86-9 appears in our catalog under these names: (3S)-3-Amino-3-(3-(methoxycarbonyl)phenyl)propanoic acid hydrochloride, 95%, (3S)-3-Amino-3-(3-(methoxycarbonyl)phenyl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3S)-3-amino-3-(3-methoxycarbonylphenyl)propanoic acid;hydrochloride (CAS 2059917-86-9) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: (3S)-3-amino-3-(3-methoxycarbonylphenyl)propanoic acid;hydrochloride. InChIKey: BKNMLQKEHWCXLP-FVGYRXGTSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-methoxycarbonylphenyl)propanoic acid;hydrochloride |
| InChIKey | BKNMLQKEHWCXLP-FVGYRXGTSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)