CAS 32404-28-7 appears in our catalog under these names: Levodopa Impurity 1 HCl, 3-Acetyl-L-tyrosine Hydrochloride, >95% (HPLC), 3-Acetyl-L-tyrosinehydrochloride, (S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid hydrochloride, 95%, 95%, (S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid hydrochloride, 95%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 2,5g, 250mg, 50mg, 25mg, 1g, 5g.
(2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid;hydrochloride (CAS 32404-28-7) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: (2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid;hydrochloride. InChIKey: QBIDLAFUWATILA-FVGYRXGTSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | (2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid;hydrochloride |
| InChIKey | QBIDLAFUWATILA-FVGYRXGTSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C[C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)