Products 1803584-17-9
CAS 1803584-17-9 is the registry number for 2-(8-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetonitrile (CAS 1803584-17-9) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetonitrile. InChIKey: BDWOWSKYNMHXST-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetonitrile |
| InChIKey | BDWOWSKYNMHXST-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Br)CC#N |
Computed by PubChem (NCBI)