CAS 1803585-99-0 appears in our catalog under these names: 2-Cyclopropanecarbonylmorpholine, trifluoroacetic acid, 95%, 2-Cyclopropanecarbonylmorpholine, trifluoroacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Cyclopropyl(morpholin-2-yl)methanone;2,2,2-trifluoroacetic acid (CAS 1803585-99-0) is a chemical compound with the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. IUPAC name: cyclopropyl(morpholin-2-yl)methanone;2,2,2-trifluoroacetic acid. InChIKey: NVBIXRLZBBVYAA-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO4 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | cyclopropyl(morpholin-2-yl)methanone;2,2,2-trifluoroacetic acid |
| InChIKey | NVBIXRLZBBVYAA-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2CNCCO2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)