CAS 2703779-40-0 is the registry number for Methyl 6-azabicyclo(3.1.1)heptane-1-carboxylate 2,2,2-trifluoroacetate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 6-azabicyclo[3.1.1]heptane-1-carboxylate;2,2,2-trifluoroacetic acid (CAS 2703779-40-0) is a chemical compound with the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. IUPAC name: methyl 6-azabicyclo[3.1.1]heptane-1-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: VIPIIPPSTFBPAJ-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO4 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | methyl 6-azabicyclo[3.1.1]heptane-1-carboxylate;2,2,2-trifluoroacetic acid |
| InChIKey | VIPIIPPSTFBPAJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCCC(C1)N2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)