Products 2939002-89-6
CAS 2939002-89-6 is the registry number for methyl 2-azaspiro[3.3]heptane-7-carboxylate,2,2,2-trifluoroacetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-azaspiro[3.3]heptane-7-carboxylate;2,2,2-trifluoroacetic acid (CAS 2939002-89-6) is a chemical compound with the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. IUPAC name: methyl 2-azaspiro[3.3]heptane-7-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: CQKIAYOTHNEZOA-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO4 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | methyl 2-azaspiro[3.3]heptane-7-carboxylate;2,2,2-trifluoroacetic acid |
| InChIKey | CQKIAYOTHNEZOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC12CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)