CAS 2567497-71-4 appears in our catalog under these names: Ethyl 5-azaspiro(2.3)hexane-1-carboxylate 2,2,2-trifluoroacetate, 98%, ethyl 5-azaspiro[2.3]hexane-1-carboxylate, trifluoroacetic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Ethyl 5-azaspiro[2.3]hexane-2-carboxylate;2,2,2-trifluoroacetic acid (CAS 2567497-71-4) is a chemical compound with the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. IUPAC name: ethyl 5-azaspiro[2.3]hexane-2-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: QHPMIENLAHQVJG-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO4 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | ethyl 5-azaspiro[2.3]hexane-2-carboxylate;2,2,2-trifluoroacetic acid |
| InChIKey | QHPMIENLAHQVJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC12CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)