Products 2166011-73-8
CAS 2166011-73-8 is the registry number for (2S,4R)-1-tert-Butoxycarbonyl-4-(trifluoromethyl)azetidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)azetidine-2-carboxylic acid (CAS 2166011-73-8) is a chemical compound with the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. IUPAC name: (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)azetidine-2-carboxylic acid. InChIKey: VWYSNRWTEOJVIC-NTSWFWBYSA-N.
| Molecular formula | C10H14F3NO4 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)azetidine-2-carboxylic acid |
| InChIKey | VWYSNRWTEOJVIC-NTSWFWBYSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C[C@@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)