CAS 1803589-40-3 appears in our catalog under these names: 1-(Azetidin-3-yl)-3,5-dimethyl-1H-1,2,4-triazole dihydrochloride, 98%, 1-(Azetidin-3-yl)-3,5-dimethyl-1H-1,2,4-triazole dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(azetidin-3-yl)-3,5-dimethyl-1,2,4-triazole;dihydrochloride (CAS 1803589-40-3) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 1-(azetidin-3-yl)-3,5-dimethyl-1,2,4-triazole;dihydrochloride. InChIKey: ZJIOCPBFMQCPEP-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 1-(azetidin-3-yl)-3,5-dimethyl-1,2,4-triazole;dihydrochloride |
| InChIKey | ZJIOCPBFMQCPEP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)C)C2CNC2.Cl.Cl |
Computed by PubChem (NCBI)