Products 1803591-77-6

CAS 1803591-77-6 is the registry number for Ethyl 2-(3-fluoropyridin-2-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-fluoro-2-pyridinyl)propanoate (CAS 1803591-77-6) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: ethyl 2-(3-fluoro-2-pyridinyl)propanoate. InChIKey: NHJAGSGKFHHLKU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12FNO2
Molecular weight197.21 g/mol
IUPAC nameethyl 2-(3-fluoro-2-pyridinyl)propanoate
InChIKeyNHJAGSGKFHHLKU-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)C1=C(C=CC=N1)F

Computed by PubChem (NCBI)