Products 1803592-03-1
CAS 1803592-03-1 is the registry number for 2-(3-(2,2,2-Trifluoroethoxy)phenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-(2,2,2-trifluoroethoxy)phenyl]ethanamine;hydrochloride (CAS 1803592-03-1) is a chemical compound with the molecular formula C10H13ClF3NO and a molecular weight of 255.66 g/mol. IUPAC name: 2-[3-(2,2,2-trifluoroethoxy)phenyl]ethanamine;hydrochloride. InChIKey: XYIXVHIYZPILFT-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3NO |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | 2-[3-(2,2,2-trifluoroethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | XYIXVHIYZPILFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)CCN.Cl |
Computed by PubChem (NCBI)