CAS 1803592-05-3 is the registry number for 5-tert-Butyl-3-(chloromethyl)-1H-1,2,4-triazole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride (CAS 1803592-05-3) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: 3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride. InChIKey: YEQLIHFCCLMOIK-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3 |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride |
| InChIKey | YEQLIHFCCLMOIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NNC(=N1)CCl.Cl |
Computed by PubChem (NCBI)