CAS 1803595-38-1 appears in our catalog under these names: Methyl 3-(2-chlorophenyl)-5-ethyl-1,2-oxazole-4-carboxylate, 95%, Methyl 3-(2-chlorophenyl)-5-ethyl-1,2-oxazole-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 3-(2-chlorophenyl)-5-ethyl-1,2-oxazole-4-carboxylate (CAS 1803595-38-1) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: methyl 3-(2-chlorophenyl)-5-ethyl-1,2-oxazole-4-carboxylate. InChIKey: OCUQLCSWRBFRAG-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | methyl 3-(2-chlorophenyl)-5-ethyl-1,2-oxazole-4-carboxylate |
| InChIKey | OCUQLCSWRBFRAG-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)OC |
Computed by PubChem (NCBI)