Products 1803595-71-2
CAS 1803595-71-2 is the registry number for 1-{5-Methyl-4H,7H-(1,2,3,4)tetrazolo(1,5-a)pyrimidin-6-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-6-yl)ethanone (CAS 1803595-71-2) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. IUPAC name: 1-(5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-6-yl)ethanone. InChIKey: OCRFNVQNVZCITG-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 1-(5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-6-yl)ethanone |
| InChIKey | OCRFNVQNVZCITG-UHFFFAOYSA-N |
| SMILES | CC1=C(CN2C(=NN=N2)N1)C(=O)C |
Computed by PubChem (NCBI)