CAS 1803599-26-9 is the registry number for 3-(Chloromethyl)-4-phenyl-4H-1,2,4-triazole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(chloromethyl)-4-phenyl-1,2,4-triazole;hydrochloride (CAS 1803599-26-9) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 3-(chloromethyl)-4-phenyl-1,2,4-triazole;hydrochloride. InChIKey: BQARLCNKIONASR-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 3-(chloromethyl)-4-phenyl-1,2,4-triazole;hydrochloride |
| InChIKey | BQARLCNKIONASR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NN=C2CCl.Cl |
Computed by PubChem (NCBI)