CAS 1803601-91-3 is the registry number for 3,5-Dibromo-4-ethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3,5-dibromo-4-ethylbenzoic acid (CAS 1803601-91-3) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 3,5-dibromo-4-ethylbenzoic acid. InChIKey: KNSTVDXADOMKQX-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 3,5-dibromo-4-ethylbenzoic acid |
| InChIKey | KNSTVDXADOMKQX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1Br)C(=O)O)Br |
Computed by PubChem (NCBI)