Products 1803601-91-3

CAS 1803601-91-3 is the registry number for 3,5-Dibromo-4-ethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3,5-dibromo-4-ethylbenzoic acid (CAS 1803601-91-3) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 3,5-dibromo-4-ethylbenzoic acid. InChIKey: KNSTVDXADOMKQX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2O2
Molecular weight307.97 g/mol
IUPAC name3,5-dibromo-4-ethylbenzoic acid
InChIKeyKNSTVDXADOMKQX-UHFFFAOYSA-N
SMILESCCC1=C(C=C(C=C1Br)C(=O)O)Br

Computed by PubChem (NCBI)