Products 1803605-31-3
CAS 1803605-31-3 is the registry number for 6-(2,2-Difluoroethoxy)pyridine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2,2-difluoroethoxy)pyridine-2-carboxamide (CAS 1803605-31-3) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: 6-(2,2-difluoroethoxy)pyridine-2-carboxamide. InChIKey: VJGMLUZYSFDGQP-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O2 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | 6-(2,2-difluoroethoxy)pyridine-2-carboxamide |
| InChIKey | VJGMLUZYSFDGQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OCC(F)F)C(=O)N |
Computed by PubChem (NCBI)