Products 1803605-41-5
CAS 1803605-41-5 is the registry number for Dimethyl(2-(4-nitrophenyl)ethyl)amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N,N-dimethyl-2-(4-nitrophenyl)ethanamine;hydrochloride (CAS 1803605-41-5) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: N,N-dimethyl-2-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: IPERYUOZMITXNN-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | N,N-dimethyl-2-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | IPERYUOZMITXNN-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)