CAS 1803607-09-1 appears in our catalog under these names: 2-Methylquinoline-5,8-diol hydrobromide, 95%, 2-Methylquinoline-5,8-diol hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methylquinoline-5,8-diol;hydrobromide (CAS 1803607-09-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 2-methylquinoline-5,8-diol;hydrobromide. InChIKey: JDOJHJOXRZKPFO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-methylquinoline-5,8-diol;hydrobromide |
| InChIKey | JDOJHJOXRZKPFO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2C=C1)O)O.Br |
Computed by PubChem (NCBI)