CAS 1803607-50-2 is the registry number for 1,2-Dimethyl-5-(methylsulfanyl)-3-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,2-dimethyl-5-methylsulfanyl-3-nitrobenzene (CAS 1803607-50-2) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1,2-dimethyl-5-methylsulfanyl-3-nitrobenzene. InChIKey: YNBNESRUDOIDSP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1,2-dimethyl-5-methylsulfanyl-3-nitrobenzene |
| InChIKey | YNBNESRUDOIDSP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])SC |
Computed by PubChem (NCBI)