CAS 1803607-71-7 is the registry number for Isoquinoline-5,8-diamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Isoquinoline-5,8-diamine;hydrochloride (CAS 1803607-71-7) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: isoquinoline-5,8-diamine;hydrochloride. InChIKey: ZUCDQUDHIYZION-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | isoquinoline-5,8-diamine;hydrochloride |
| InChIKey | ZUCDQUDHIYZION-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NC=CC2=C1N)N.Cl |
Computed by PubChem (NCBI)