CAS 1803608-19-6 appears in our catalog under these names: 2-Methyl-4,5,6,7-tetrahydro-1H-1,3-benzodiazol-5-amine dihydrochloride, 95%, 2-Methyl-4,5,6,7-tetrahydro-1H-1,3-benzodiazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-4,5,6,7-tetrahydro-3H-benzimidazol-5-amine;dihydrochloride (CAS 1803608-19-6) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: NQDQXKTWEFSMPP-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | NQDQXKTWEFSMPP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)CC(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)