CAS 1803609-89-3 is the registry number for 5-Chloro-2-sulfamoylthiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloro-2-sulfamoylthiophene-3-carboxylic acid (CAS 1803609-89-3) is a chemical compound with the molecular formula C5H4ClNO4S2 and a molecular weight of 241.7 g/mol. IUPAC name: 5-chloro-2-sulfamoylthiophene-3-carboxylic acid. InChIKey: FXGXDNNQYCHIFM-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO4S2 |
|---|---|
| Molecular weight | 241.7 g/mol |
| IUPAC name | 5-chloro-2-sulfamoylthiophene-3-carboxylic acid |
| InChIKey | FXGXDNNQYCHIFM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1C(=O)O)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)