Products 1803610-43-6
CAS 1803610-43-6 is the registry number for 4-(Chloromethyl)-N,N,2-trimethylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(chloromethyl)-N,N,2-trimethylaniline;hydrochloride (CAS 1803610-43-6) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 4-(chloromethyl)-N,N,2-trimethylaniline;hydrochloride. InChIKey: PWOSJCCZHQBDFY-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 4-(chloromethyl)-N,N,2-trimethylaniline;hydrochloride |
| InChIKey | PWOSJCCZHQBDFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CCl)N(C)C.Cl |
Computed by PubChem (NCBI)