CAS 1803611-90-6 appears in our catalog under these names: 1-(1-Methyl-3,5-bis(trifluoromethyl)-1H-pyrrol-2-yl)ethan-1-one, 95%, 1-(1-Methyl-3,5-bis(trifluoromethyl)-1H-pyrrol-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]ethanone (CAS 1803611-90-6) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 1-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]ethanone. InChIKey: WJYNHFYZLZVUDI-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 1-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]ethanone |
| InChIKey | WJYNHFYZLZVUDI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(N1C)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)