CAS 1803612-01-2 appears in our catalog under these names: 3-((Dimethylamino)methyl)furan-2-carboxylic acid hydrochloride, 3-((Dimethylamino)methyl)furan-2-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-[(dimethylamino)methyl]furan-2-carboxylic acid;hydrochloride (CAS 1803612-01-2) is a chemical compound with the molecular formula C8H12ClNO3 and a molecular weight of 205.64 g/mol. IUPAC name: 3-[(dimethylamino)methyl]furan-2-carboxylic acid;hydrochloride. InChIKey: KFLPFGNRVLQXDO-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]furan-2-carboxylic acid;hydrochloride |
| InChIKey | KFLPFGNRVLQXDO-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(OC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)