Products 1803729-23-8

CAS 1803729-23-8 is the registry number for Ethyl 2,4-difluoro-5-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,4-difluoro-5-methoxybenzoate (CAS 1803729-23-8) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: ethyl 2,4-difluoro-5-methoxybenzoate. InChIKey: IPERKERYXJMSCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O3
Molecular weight216.18 g/mol
IUPAC nameethyl 2,4-difluoro-5-methoxybenzoate
InChIKeyIPERKERYXJMSCJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1F)F)OC

Computed by PubChem (NCBI)