Products 1803830-08-1
CAS 1803830-08-1 is the registry number for 3,5-Dibromo-2,4-difluorobenzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3,5-dibromo-2,4-difluoroaniline (CAS 1803830-08-1) is a chemical compound with the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. IUPAC name: 3,5-dibromo-2,4-difluoroaniline. InChIKey: MEVAUGPPJAUDOU-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F2N |
|---|---|
| Molecular weight | 286.90 g/mol |
| IUPAC name | 3,5-dibromo-2,4-difluoroaniline |
| InChIKey | MEVAUGPPJAUDOU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)Br)F)N |
Computed by PubChem (NCBI)