CAS 1435806-67-9 is the registry number for 2,3-Dibromo-5,6-difluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dibromo-5,6-difluoroaniline (CAS 1435806-67-9) is a chemical compound with the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. IUPAC name: 2,3-dibromo-5,6-difluoroaniline. InChIKey: BFIHQVNAMHSSNW-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F2N |
|---|---|
| Molecular weight | 286.90 g/mol |
| IUPAC name | 2,3-dibromo-5,6-difluoroaniline |
| InChIKey | BFIHQVNAMHSSNW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)N)F)F |
Computed by PubChem (NCBI)