CAS 1805252-89-4 appears in our catalog under these names: 3,5-Dibromo-4-(difluoromethyl)pyridine, 98%, 3,5-Dibromo-4-(difluoromethyl)pyridine, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
3,5-dibromo-4-(difluoromethyl)pyridine (CAS 1805252-89-4) is a chemical compound with the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. IUPAC name: 3,5-dibromo-4-(difluoromethyl)pyridine. InChIKey: RLRAUAVFQHWDSG-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F2N |
|---|---|
| Molecular weight | 286.90 g/mol |
| IUPAC name | 3,5-dibromo-4-(difluoromethyl)pyridine |
| InChIKey | RLRAUAVFQHWDSG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)C(F)F)Br |
Computed by PubChem (NCBI)