CAS 883549-00-6 appears in our catalog under these names: 2,4-Dibromo-3,5-difluoroaniline, 98%, 2,4-Dibromo-3,5-difluoroaniline. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g.
2,4-dibromo-3,5-difluoroaniline (CAS 883549-00-6) is a chemical compound with the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. IUPAC name: 2,4-dibromo-3,5-difluoroaniline. InChIKey: GZFQXNPSPLBCNZ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F2N |
|---|---|
| Molecular weight | 286.90 g/mol |
| IUPAC name | 2,4-dibromo-3,5-difluoroaniline |
| InChIKey | GZFQXNPSPLBCNZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)Br)N |
Computed by PubChem (NCBI)