CAS 1000574-69-5 appears in our catalog under these names: 2,6-Dibromo-3,4-difluoroaniline, 97%, 2,6-Dibromo-3,4-difluoroaniline, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2,6-dibromo-3,4-difluoroaniline (CAS 1000574-69-5) is a chemical compound with the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. IUPAC name: 2,6-dibromo-3,4-difluoroaniline. InChIKey: HWBMIUQUYPJTFK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F2N |
|---|---|
| Molecular weight | 286.90 g/mol |
| IUPAC name | 2,6-dibromo-3,4-difluoroaniline |
| InChIKey | HWBMIUQUYPJTFK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)N)Br)F)F |
Computed by PubChem (NCBI)