Products 702640-60-6
CAS 702640-60-6 is the registry number for 2,5-Dibromo-3,6-difluoroaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
2,5-dibromo-3,6-difluoroaniline (CAS 702640-60-6) is a chemical compound with the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. IUPAC name: 2,5-dibromo-3,6-difluoroaniline. InChIKey: WGEBCSMFNOMGOE-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F2N |
|---|---|
| Molecular weight | 286.90 g/mol |
| IUPAC name | 2,5-dibromo-3,6-difluoroaniline |
| InChIKey | WGEBCSMFNOMGOE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)N)Br)F |
Computed by PubChem (NCBI)