Products 1804051-34-0

CAS 1804051-34-0 is the registry number for 5-Fluoro-4-methyl-2-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-fluoro-4-methyl-2-nitrobenzenesulfonyl chloride (CAS 1804051-34-0) is a chemical compound with the molecular formula C7H5ClFNO4S and a molecular weight of 253.64 g/mol. IUPAC name: 5-fluoro-4-methyl-2-nitrobenzenesulfonyl chloride. InChIKey: XBQSXRWIHJKJRS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClFNO4S
Molecular weight253.64 g/mol
IUPAC name5-fluoro-4-methyl-2-nitrobenzenesulfonyl chloride
InChIKeyXBQSXRWIHJKJRS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1F)S(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)