Products 1804907-88-7
CAS 1804907-88-7 is the registry number for 2-bromo-5-fluoro-4-hydroxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-bromo-5-fluoro-4-hydroxybenzoic acid (CAS 1804907-88-7) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 2-bromo-5-fluoro-4-hydroxybenzoic acid. InChIKey: FUBPKMLIGRQCCI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-hydroxybenzoic acid |
| InChIKey | FUBPKMLIGRQCCI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)O)Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-5-fluoro-4-hydroxybenzoic acid