CAS 1805032-48-7 is the registry number for 2-Bromo-5-methyl-3-nitrobenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-bromo-5-methyl-3-nitrobenzaldehyde (CAS 1805032-48-7) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-bromo-5-methyl-3-nitrobenzaldehyde. InChIKey: PBJSKAQURULIDE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-bromo-5-methyl-3-nitrobenzaldehyde |
| InChIKey | PBJSKAQURULIDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])Br)C=O |
Computed by PubChem (NCBI)