CAS 1805123-35-6 appears in our catalog under these names: 1,2-Dibromo-3-fluoro-4-nitrobenzene, 98%, 1,2-Dibromo-3-fluoro-4-nitrobenzene, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1,2-dibromo-3-fluoro-4-nitrobenzene (CAS 1805123-35-6) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,2-dibromo-3-fluoro-4-nitrobenzene. InChIKey: ODFWTDJLAFTAAX-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,2-dibromo-3-fluoro-4-nitrobenzene |
| InChIKey | ODFWTDJLAFTAAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)Br)Br |
Computed by PubChem (NCBI)