CAS 366496-33-5 appears in our catalog under these names: 1,4-Dibromo-2-fluoro-5-nitrobenzene 97%, 1,4-Dibromo-2-fluoro-5-nitrobenzene, 97%, 97%, 2,5-Dibromo-4-fluoronitrobenzene, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g, 250mg.
1,4-dibromo-2-fluoro-5-nitrobenzene (CAS 366496-33-5) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,4-dibromo-2-fluoro-5-nitrobenzene. InChIKey: WDFCYQDGGDTTCT-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,4-dibromo-2-fluoro-5-nitrobenzene |
| InChIKey | WDFCYQDGGDTTCT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)