CAS 1807056-85-4 appears in our catalog under these names: 1,2–Dibromo–4–fluoro–5–nitrobenzene, 1,2-Dibromo-4-fluoro-5-nitrobenzene 97%, 1,2-Dibromo-4-fluoro-5-nitrobenzene, 97%, 1,2-Dibromo-4-fluoro-5-nitrobenzene, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
1,2-dibromo-4-fluoro-5-nitrobenzene (CAS 1807056-85-4) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,2-dibromo-4-fluoro-5-nitrobenzene. InChIKey: LRCZUASJNJXPAY-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,2-dibromo-4-fluoro-5-nitrobenzene |
| InChIKey | LRCZUASJNJXPAY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)