CAS 1807182-22-4 is the registry number for 1,4-Dibromo-2-fluoro-6-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,5-dibromo-1-fluoro-3-nitrobenzene (CAS 1807182-22-4) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 2,5-dibromo-1-fluoro-3-nitrobenzene. InChIKey: OKYXXFZQDSEMOG-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 2,5-dibromo-1-fluoro-3-nitrobenzene |
| InChIKey | OKYXXFZQDSEMOG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Br)F)Br |
Computed by PubChem (NCBI)