CAS 1806307-23-2 is the registry number for 1,4-Dibromo-2-fluoro-3-nitrobenzene, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1,4-dibromo-2-fluoro-3-nitrobenzene (CAS 1806307-23-2) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,4-dibromo-2-fluoro-3-nitrobenzene. InChIKey: MVRXBTHSLILSFX-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,4-dibromo-2-fluoro-3-nitrobenzene |
| InChIKey | MVRXBTHSLILSFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)