CAS 1805553-40-5 appears in our catalog under these names: 3-Bromo-5-methyl-4-nitrobenzaldehyde, 98%, 3-Bromo-5-methyl-4-nitrobenzaldehyde, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-5-methyl-4-nitrobenzaldehyde (CAS 1805553-40-5) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 3-bromo-5-methyl-4-nitrobenzaldehyde. InChIKey: RPYXENLPRAPNEL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 3-bromo-5-methyl-4-nitrobenzaldehyde |
| InChIKey | RPYXENLPRAPNEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])Br)C=O |
Computed by PubChem (NCBI)