Products 1805589-29-0
CAS 1805589-29-0 appears in our catalog under these names: 4–Bromo–2–fluoro–6–hydroxybenzoic acid, 4-Bromo-2-fluoro-6-hydroxybenzoic acid, 4-Bromo-2-fluoro-6-hydroxybenzoic acid 95%, 4-Bromo-2-fluoro-6-hydroxybenzoic acid, 95%, 95%, 4-Bromo-2-fluoro-6-hydroxybenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g, 10g.
4-bromo-2-fluoro-6-hydroxybenzoic acid (CAS 1805589-29-0) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 4-bromo-2-fluoro-6-hydroxybenzoic acid. InChIKey: UVBFBKRMQUEMBG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-6-hydroxybenzoic acid |
| InChIKey | UVBFBKRMQUEMBG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C(=O)O)F)Br |
Computed by PubChem (NCBI)