CAS 1805648-76-3 is the registry number for Methyl 5-chloro-6-nitronicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chloro-6-nitropyridine-3-carboxylate (CAS 1805648-76-3) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: methyl 5-chloro-6-nitropyridine-3-carboxylate. InChIKey: SXNXGPMIKKFYFA-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | methyl 5-chloro-6-nitropyridine-3-carboxylate |
| InChIKey | SXNXGPMIKKFYFA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)