CAS 1805673-29-3 appears in our catalog under these names: 4-Chloro-2-methyl-5-nitrobenzaldehyde 98%, 4-Chloro-2-methyl-5-nitrobenzaldehyde, 98%, 98%, 4-Chloro-2-methyl-5-nitrobenzaldehyde, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-2-methyl-5-nitrobenzaldehyde (CAS 1805673-29-3) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 4-chloro-2-methyl-5-nitrobenzaldehyde. InChIKey: RFQBHQVYOPOZSF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 4-chloro-2-methyl-5-nitrobenzaldehyde |
| InChIKey | RFQBHQVYOPOZSF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C=O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)