Products 1806363-46-1
CAS 1806363-46-1 is the registry number for 2-(Difluoromethyl)-3,6-difluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-(difluoromethyl)-3,6-difluorobenzoic acid (CAS 1806363-46-1) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(difluoromethyl)-3,6-difluorobenzoic acid. InChIKey: GJTLANIGYVLGGH-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(difluoromethyl)-3,6-difluorobenzoic acid |
| InChIKey | GJTLANIGYVLGGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(F)F)C(=O)O)F |
Computed by PubChem (NCBI)