Products 1806364-31-7
CAS 1806364-31-7 is the registry number for (4-(Difluoromethyl)-2,6-difluorophenyl)methanol, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
[4-(difluoromethyl)-2,6-difluorophenyl]methanol (CAS 1806364-31-7) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: [4-(difluoromethyl)-2,6-difluorophenyl]methanol. InChIKey: APUSHCPLMCKERR-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | [4-(difluoromethyl)-2,6-difluorophenyl]methanol |
| InChIKey | APUSHCPLMCKERR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CO)F)C(F)F |
Computed by PubChem (NCBI)